C9H5BF6 — CID 162573398
CID 162573398 (PubChem CID 162573398) has the molecular formula C9H5BF6 and a molecular weight of 237.94 g/mol.
| Compound Name | CID 162573398 |
|---|---|
| PubChem CID | 162573398 |
| Molecular Formula | C9H5BF6 |
| Molecular Weight | 237.94 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | — |
| SMILES | [B]C(c1cccc(C(F)(F)F)c1)C(F)(F)F |
| InChI | InChI=1S/C9H5BF6/c10-7(9(14,15)16)5-2-1-3-6(4-5)8(11,12)13/h1-4,7H |
| InChIKey | KTXKZAYOSUUVAC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.94 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|