C3H2F7Sb — CID 173388121
1,1,2,2,3,3,3-heptafluoropropylstibane (PubChem CID 173388121) has the molecular formula C3H2F7Sb and a molecular weight of 292.80 g/mol. Its IUPAC name is 1,1,2,2,3,3,3-heptafluoropropylstibane.
| Compound Name | 1,1,2,2,3,3,3-heptafluoropropylstibane |
|---|---|
| PubChem CID | 173388121 |
| Molecular Formula | C3H2F7Sb |
| Molecular Weight | 292.80 g/mol |
| Exact Mass | 291.91 |
| IUPAC Name | 1,1,2,2,3,3,3-heptafluoropropylstibane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)[SbH2] |
| InChI | InChI=1S/C3F7.Sb.2H/c4-1(5)2(6,7)3(8,9)10;;; |
| InChIKey | CEDPXNPFWLZHQB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.80 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|