C4AsF9+ — CID 22349056
CID 22349056 (PubChem CID 22349056) has the molecular formula C4AsF9+ and a molecular weight of 293.95 g/mol.
| Compound Name | CID 22349056 |
|---|---|
| PubChem CID | 22349056 |
| Molecular Formula | C4AsF9+ |
| Molecular Weight | 293.95 g/mol |
| Exact Mass | 293.91 |
| IUPAC Name | — |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)[As+] |
| InChI | InChI=1S/C4AsF9/c5-3(10,11)1(6,7)2(8,9)4(12,13)14/q+1 |
| InChIKey | HHZJZDXJBOWZNH-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.95 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|