C26H12F42OS2 — CID 21315345
5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)hexan-1-ol (PubChem CID 21315345) has the molecular formula C26H12F42OS2 and a molecular weight of 1202.43 g/mol. Its IUPAC name is 5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)hexan-1-ol.
| Compound Name | 5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)hexan-1-ol |
|---|---|
| PubChem CID | 21315345 |
| Molecular Formula | C26H12F42OS2 |
| Molecular Weight | 1202.43 g/mol |
| Exact Mass | 1201.97 |
| IUPAC Name | 5,6-bis(1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-henicosafluorodecylsulfanyl)hexan-1-ol |
| SMILES | OCCCCC(CSC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C26H12F42OS2/c27-7(28,11(35,36)15(43,44)19(51,52)23(59,60)61)9(31,32)13(39,40)17(47,48)21(55,56)25(65,66)70-5-6(3-1-2-4-69)71-26(67,68)22(57,58)18(49,50)14(41,42)10(33,34)8(29,30)12(37,38)16(45,46)20(53,54)24(62,63)64/h6,69H,1-5H2 |
| InChIKey | PAFIYNGKYOWFCY-UHFFFAOYSA-N |
| XLogP | 15.46 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1202.43 |
| LogP ≤ 5 | 15.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|