C30H46F16O2 — CID 138631372
10-(2,2,4,4,5,5,5-heptafluoropentyl)-11-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane-1,20-diol (PubChem CID 138631372) has the molecular formula C30H46F16O2 and a molecular weight of 742.66 g/mol. Its IUPAC name is 10-(2,2,4,4,5,5,5-heptafluoropentyl)-11-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane-1,20-diol.
| Compound Name | 10-(2,2,4,4,5,5,5-heptafluoropentyl)-11-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane-1,20-diol |
|---|---|
| PubChem CID | 138631372 |
| Molecular Formula | C30H46F16O2 |
| Molecular Weight | 742.66 g/mol |
| Exact Mass | 742.32 |
| IUPAC Name | 10-(2,2,4,4,5,5,5-heptafluoropentyl)-11-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane-1,20-diol |
| SMILES | OCCCCCCCCCC(CC(F)(F)CC(F)(F)C(F)(F)F)C(CCCCCCCCCO)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H46F16O2/c31-24(32,21-26(35,36)29(41,42)43)19-22(15-11-7-3-1-5-9-13-17-47)23(16-12-8-4-2-6-10-14-18-48)20-25(33,34)27(37,38)28(39,40)30(44,45)46/h22-23,47-48H,1-21H2 |
| InChIKey | RMZWNNZQITYKQW-UHFFFAOYSA-N |
| XLogP | 11.92 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 742.66 |
| LogP ≤ 5 | 11.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|