C30H42Br2F18 — CID 130221393
1,20-dibromo-10,11-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane (PubChem CID 130221393) has the molecular formula C30H42Br2F18 and a molecular weight of 904.44 g/mol. Its IUPAC name is 1,20-dibromo-10,11-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane.
| Compound Name | 1,20-dibromo-10,11-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane |
|---|---|
| PubChem CID | 130221393 |
| Molecular Formula | C30H42Br2F18 |
| Molecular Weight | 904.44 g/mol |
| Exact Mass | 902.14 |
| IUPAC Name | 1,20-dibromo-10,11-bis(2,2,3,3,4,4,5,5,5-nonafluoropentyl)icosane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(CCCCCCCCCBr)C(CCCCCCCCCBr)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C30H42Br2F18/c31-17-13-9-5-1-3-7-11-15-21(19-23(33,34)25(37,38)27(41,42)29(45,46)47)22(16-12-8-4-2-6-10-14-18-32)20-24(35,36)26(39,40)28(43,44)30(48,49)50/h21-22H,1-20H2 |
| InChIKey | SHUPUBIDYZHJQD-UHFFFAOYSA-N |
| XLogP | 14.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 27 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 904.44 |
| LogP ≤ 5 | 14.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|