C14H24BrF5S — CID 87371241
14-bromo-1,1,1,2,2-pentafluorotetradecane-5-thiol (PubChem CID 87371241) has the molecular formula C14H24BrF5S and a molecular weight of 399.31 g/mol. Its IUPAC name is 14-bromo-1,1,1,2,2-pentafluorotetradecane-5-thiol.
| Compound Name | 14-bromo-1,1,1,2,2-pentafluorotetradecane-5-thiol |
|---|---|
| PubChem CID | 87371241 |
| Molecular Formula | C14H24BrF5S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 14-bromo-1,1,1,2,2-pentafluorotetradecane-5-thiol |
| SMILES | FC(F)(F)C(F)(F)CCC(S)CCCCCCCCCBr |
| InChI | InChI=1S/C14H24BrF5S/c15-11-7-5-3-1-2-4-6-8-12(21)9-10-13(16,17)14(18,19)20/h12,21H,1-11H2 |
| InChIKey | IESXENOIMZQFIE-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|