C20H30Cl2F10S — CID 141373597
10-chloro-5-(10-chloro-1,1,1,2,2-pentafluorodecan-5-yl)sulfanyl-1,1,1,2,2-pentafluorodecane (PubChem CID 141373597) has the molecular formula C20H30Cl2F10S and a molecular weight of 563.41 g/mol. Its IUPAC name is 10-chloro-5-(10-chloro-1,1,1,2,2-pentafluorodecan-5-yl)sulfanyl-1,1,1,2,2-pentafluorodecane.
| Compound Name | 10-chloro-5-(10-chloro-1,1,1,2,2-pentafluorodecan-5-yl)sulfanyl-1,1,1,2,2-pentafluorodecane |
|---|---|
| PubChem CID | 141373597 |
| Molecular Formula | C20H30Cl2F10S |
| Molecular Weight | 563.41 g/mol |
| Exact Mass | 562.13 |
| IUPAC Name | 10-chloro-5-(10-chloro-1,1,1,2,2-pentafluorodecan-5-yl)sulfanyl-1,1,1,2,2-pentafluorodecane |
| SMILES | FC(F)(F)C(F)(F)CCC(CCCCCCl)SC(CCCCCCl)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H30Cl2F10S/c21-13-5-1-3-7-15(9-11-17(23,24)19(27,28)29)33-16(8-4-2-6-14-22)10-12-18(25,26)20(30,31)32/h15-16H,1-14H2 |
| InChIKey | JLHNDOWJJLWGTI-UHFFFAOYSA-N |
| XLogP | 10.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.41 |
| LogP ≤ 5 | 10.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|