C18H28ClF5O4 — CID 54534392
diethyl 2-(11-chloro-1,1,1,2,2-pentafluoroundecan-5-yl)propanedioate (PubChem CID 54534392) has the molecular formula C18H28ClF5O4 and a molecular weight of 438.86 g/mol. Its IUPAC name is diethyl 2-(11-chloro-1,1,1,2,2-pentafluoroundecan-5-yl)propanedioate.
| Compound Name | diethyl 2-(11-chloro-1,1,1,2,2-pentafluoroundecan-5-yl)propanedioate |
|---|---|
| PubChem CID | 54534392 |
| Molecular Formula | C18H28ClF5O4 |
| Molecular Weight | 438.86 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | diethyl 2-(11-chloro-1,1,1,2,2-pentafluoroundecan-5-yl)propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(CCCCCCCl)CCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C18H28ClF5O4/c1-3-27-15(25)14(16(26)28-4-2)13(9-7-5-6-8-12-19)10-11-17(20,21)18(22,23)24/h13-14H,3-12H2,1-2H3 |
| InChIKey | YYTIPLJKWBSDEU-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.86 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|