C15H25F5O2S — CID 87340075
ethyl 4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoate (PubChem CID 87340075) has the molecular formula C15H25F5O2S and a molecular weight of 364.42 g/mol. Its IUPAC name is ethyl 4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoate.
| Compound Name | ethyl 4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87340075 |
| Molecular Formula | C15H25F5O2S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | ethyl 4-methyl-2-(6,6,7,7,7-pentafluoroheptylsulfanyl)pentanoate |
| SMILES | CCOC(=O)C(CC(C)C)SCCCCCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H25F5O2S/c1-4-22-13(21)12(10-11(2)3)23-9-7-5-6-8-14(16,17)15(18,19)20/h11-12H,4-10H2,1-3H3 |
| InChIKey | ACJYWMIEGCPMKF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|