C16H29F3O2S — CID 87340124
propyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate (PubChem CID 87340124) has the molecular formula C16H29F3O2S and a molecular weight of 342.47 g/mol. Its IUPAC name is propyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate.
| Compound Name | propyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87340124 |
| Molecular Formula | C16H29F3O2S |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | propyl 4-methyl-2-(7,7,7-trifluoroheptylsulfanyl)pentanoate |
| SMILES | CCCOC(=O)C(CC(C)C)SCCCCCCC(F)(F)F |
| InChI | InChI=1S/C16H29F3O2S/c1-4-10-21-15(20)14(12-13(2)3)22-11-8-6-5-7-9-16(17,18)19/h13-14H,4-12H2,1-3H3 |
| InChIKey | OAUZRKLTTBSBFC-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|