C15H27F3O2S — CID 87342302
2-methylpropyl 4-methyl-2-(5,5,5-trifluoropentylsulfanyl)pentanoate (PubChem CID 87342302) has the molecular formula C15H27F3O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is 2-methylpropyl 4-methyl-2-(5,5,5-trifluoropentylsulfanyl)pentanoate.
| Compound Name | 2-methylpropyl 4-methyl-2-(5,5,5-trifluoropentylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87342302 |
| Molecular Formula | C15H27F3O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 2-methylpropyl 4-methyl-2-(5,5,5-trifluoropentylsulfanyl)pentanoate |
| SMILES | CC(C)COC(=O)C(CC(C)C)SCCCCC(F)(F)F |
| InChI | InChI=1S/C15H27F3O2S/c1-11(2)9-13(14(19)20-10-12(3)4)21-8-6-5-7-15(16,17)18/h11-13H,5-10H2,1-4H3 |
| InChIKey | FYDSFXQGCDBXQE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|