C14H25F3O2S — CID 87342202
2-methylpropyl 2-(4,4,4-trifluorobutylsulfanyl)hexanoate (PubChem CID 87342202) has the molecular formula C14H25F3O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is 2-methylpropyl 2-(4,4,4-trifluorobutylsulfanyl)hexanoate.
| Compound Name | 2-methylpropyl 2-(4,4,4-trifluorobutylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 87342202 |
| Molecular Formula | C14H25F3O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | 2-methylpropyl 2-(4,4,4-trifluorobutylsulfanyl)hexanoate |
| SMILES | CCCCC(SCCCC(F)(F)F)C(=O)OCC(C)C |
| InChI | InChI=1S/C14H25F3O2S/c1-4-5-7-12(13(18)19-10-11(2)3)20-9-6-8-14(15,16)17/h11-12H,4-10H2,1-3H3 |
| InChIKey | LIGCVMWMDXCRIK-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|