C17H25F9O2S — CID 87340048
2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)hexanoate (PubChem CID 87340048) has the molecular formula C17H25F9O2S and a molecular weight of 464.43 g/mol. Its IUPAC name is 2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)hexanoate.
| Compound Name | 2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)hexanoate |
|---|---|
| PubChem CID | 87340048 |
| Molecular Formula | C17H25F9O2S |
| Molecular Weight | 464.43 g/mol |
| Exact Mass | 464.14 |
| IUPAC Name | 2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)hexanoate |
| SMILES | CCCCC(SCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC(C)C |
| InChI | InChI=1S/C17H25F9O2S/c1-4-5-7-12(13(27)28-10-11(2)3)29-9-6-8-14(18,19)15(20,21)16(22,23)17(24,25)26/h11-12H,4-10H2,1-3H3 |
| InChIKey | FPNBSOQILHNZFH-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.43 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|