C18H27F9O2S — CID 87341942
2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)heptanoate (PubChem CID 87341942) has the molecular formula C18H27F9O2S and a molecular weight of 478.46 g/mol. Its IUPAC name is 2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)heptanoate.
| Compound Name | 2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)heptanoate |
|---|---|
| PubChem CID | 87341942 |
| Molecular Formula | C18H27F9O2S |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | 2-methylpropyl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)heptanoate |
| SMILES | CCCCCC(SCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)OCC(C)C |
| InChI | InChI=1S/C18H27F9O2S/c1-4-5-6-8-13(14(28)29-11-12(2)3)30-10-7-9-15(19,20)16(21,22)17(23,24)18(25,26)27/h12-13H,4-11H2,1-3H3 |
| InChIKey | FDWXCIOTELKAKX-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|