C16H27F5O2S — CID 87339996
2-methylpropyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate (PubChem CID 87339996) has the molecular formula C16H27F5O2S and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-methylpropyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate.
| Compound Name | 2-methylpropyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87339996 |
| Molecular Formula | C16H27F5O2S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | 2-methylpropyl 4-methyl-2-(4,4,5,6,6-pentafluorohexylsulfanyl)pentanoate |
| SMILES | CC(C)COC(=O)C(CC(C)C)SCCCC(F)(F)C(F)C(F)F |
| InChI | InChI=1S/C16H27F5O2S/c1-10(2)8-12(15(22)23-9-11(3)4)24-7-5-6-16(20,21)13(17)14(18)19/h10-14H,5-9H2,1-4H3 |
| InChIKey | BUZFERARJUYGAB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|