C17H29F5O2S — CID 87341752
tert-butyl 2-(4,4,5,6,6-pentafluorohexylsulfanyl)heptanoate (PubChem CID 87341752) has the molecular formula C17H29F5O2S and a molecular weight of 392.47 g/mol. Its IUPAC name is tert-butyl 2-(4,4,5,6,6-pentafluorohexylsulfanyl)heptanoate.
| Compound Name | tert-butyl 2-(4,4,5,6,6-pentafluorohexylsulfanyl)heptanoate |
|---|---|
| PubChem CID | 87341752 |
| Molecular Formula | C17H29F5O2S |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | tert-butyl 2-(4,4,5,6,6-pentafluorohexylsulfanyl)heptanoate |
| SMILES | CCCCCC(SCCCC(F)(F)C(F)C(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H29F5O2S/c1-5-6-7-9-12(15(23)24-16(2,3)4)25-11-8-10-17(21,22)13(18)14(19)20/h12-14H,5-11H2,1-4H3 |
| InChIKey | MZYPTPOUNKEWGA-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|