C14H25F3O2S — CID 87341099
tert-butyl 2-(3,3,3-trifluoropropylsulfanyl)heptanoate (PubChem CID 87341099) has the molecular formula C14H25F3O2S and a molecular weight of 314.41 g/mol. Its IUPAC name is tert-butyl 2-(3,3,3-trifluoropropylsulfanyl)heptanoate.
| Compound Name | tert-butyl 2-(3,3,3-trifluoropropylsulfanyl)heptanoate |
|---|---|
| PubChem CID | 87341099 |
| Molecular Formula | C14H25F3O2S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | tert-butyl 2-(3,3,3-trifluoropropylsulfanyl)heptanoate |
| SMILES | CCCCCC(SCCC(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25F3O2S/c1-5-6-7-8-11(12(18)19-13(2,3)4)20-10-9-14(15,16)17/h11H,5-10H2,1-4H3 |
| InChIKey | GTJUGYWVLSPINV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|