C15H26F4O2S — CID 87340073
2-methylpropyl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate (PubChem CID 87340073) has the molecular formula C15H26F4O2S and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-methylpropyl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate.
| Compound Name | 2-methylpropyl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87340073 |
| Molecular Formula | C15H26F4O2S |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | 2-methylpropyl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate |
| SMILES | CC(C)COC(=O)C(CC(C)C)SCCCC(F)(F)C(F)F |
| InChI | InChI=1S/C15H26F4O2S/c1-10(2)8-12(13(20)21-9-11(3)4)22-7-5-6-15(18,19)14(16)17/h10-12,14H,5-9H2,1-4H3 |
| InChIKey | CTOLXIBCFHGQFD-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|