C17H32F2O2S — CID 87340950
2-methylpropyl 2-(6,6-difluoroheptylsulfanyl)-4-methylpentanoate (PubChem CID 87340950) has the molecular formula C17H32F2O2S and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-methylpropyl 2-(6,6-difluoroheptylsulfanyl)-4-methylpentanoate.
| Compound Name | 2-methylpropyl 2-(6,6-difluoroheptylsulfanyl)-4-methylpentanoate |
|---|---|
| PubChem CID | 87340950 |
| Molecular Formula | C17H32F2O2S |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 2-methylpropyl 2-(6,6-difluoroheptylsulfanyl)-4-methylpentanoate |
| SMILES | CC(C)COC(=O)C(CC(C)C)SCCCCCC(C)(F)F |
| InChI | InChI=1S/C17H32F2O2S/c1-13(2)11-15(16(20)21-12-14(3)4)22-10-8-6-7-9-17(5,18)19/h13-15H,6-12H2,1-5H3 |
| InChIKey | HWBKLTXNYVEMQD-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|