C11H20F2O2S — CID 87340152
2-(5,5-difluorohexylsulfanyl)-3-methylbutanoic acid (PubChem CID 87340152) has the molecular formula C11H20F2O2S and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-(5,5-difluorohexylsulfanyl)-3-methylbutanoic acid.
| Compound Name | 2-(5,5-difluorohexylsulfanyl)-3-methylbutanoic acid |
|---|---|
| PubChem CID | 87340152 |
| Molecular Formula | C11H20F2O2S |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-(5,5-difluorohexylsulfanyl)-3-methylbutanoic acid |
| SMILES | CC(C)C(SCCCCC(C)(F)F)C(=O)O |
| InChI | InChI=1S/C11H20F2O2S/c1-8(2)9(10(14)15)16-7-5-4-6-11(3,12)13/h8-9H,4-7H2,1-3H3,(H,14,15) |
| InChIKey | BIYGPODBHMWDCL-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|