C14H26F2O2S — CID 87341950
tert-butyl 2-(4,4-difluoropentylsulfanyl)-3-methylbutanoate (PubChem CID 87341950) has the molecular formula C14H26F2O2S and a molecular weight of 296.42 g/mol. Its IUPAC name is tert-butyl 2-(4,4-difluoropentylsulfanyl)-3-methylbutanoate.
| Compound Name | tert-butyl 2-(4,4-difluoropentylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 87341950 |
| Molecular Formula | C14H26F2O2S |
| Molecular Weight | 296.42 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | tert-butyl 2-(4,4-difluoropentylsulfanyl)-3-methylbutanoate |
| SMILES | CC(C)C(SCCCC(C)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H26F2O2S/c1-10(2)11(12(17)18-13(3,4)5)19-9-7-8-14(6,15)16/h10-11H,7-9H2,1-6H3 |
| InChIKey | XQMUHRZZZXCONB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.42 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|