C12H17F7O2S — CID 87339717
methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate (PubChem CID 87339717) has the molecular formula C12H17F7O2S and a molecular weight of 358.32 g/mol. Its IUPAC name is methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate.
| Compound Name | methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate |
|---|---|
| PubChem CID | 87339717 |
| Molecular Formula | C12H17F7O2S |
| Molecular Weight | 358.32 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | methyl 2-(4,4,5,5,6,6,6-heptafluorohexylsulfanyl)-3-methylbutanoate |
| SMILES | COC(=O)C(SCCCC(F)(F)C(F)(F)C(F)(F)F)C(C)C |
| InChI | InChI=1S/C12H17F7O2S/c1-7(2)8(9(20)21-3)22-6-4-5-10(13,14)11(15,16)12(17,18)19/h7-8H,4-6H2,1-3H3 |
| InChIKey | NREDIIHKGLRWPV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.32 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|