C12H15F9O2S — CID 123377359
propan-2-yl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)acetate (PubChem CID 123377359) has the molecular formula C12H15F9O2S and a molecular weight of 394.30 g/mol. Its IUPAC name is propan-2-yl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)acetate.
| Compound Name | propan-2-yl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)acetate |
|---|---|
| PubChem CID | 123377359 |
| Molecular Formula | C12H15F9O2S |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | propan-2-yl 2-(4,4,5,5,6,6,7,7,7-nonafluoroheptylsulfanyl)acetate |
| SMILES | CC(C)OC(=O)CSCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F9O2S/c1-7(2)23-8(22)6-24-5-3-4-9(13,14)10(15,16)11(17,18)12(19,20)21/h7H,3-6H2,1-2H3 |
| InChIKey | KIBSYNQNYTZRDH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|