methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate

C8H13F3O2S — CID 123894858

IUPACmethyl 2-(5,5,5-trifluoropentylsulfanyl)acetate
SMILESCOC(=O)CSCCCCC(F)(F)F
InChIInChI=1S/C8H13F3O2S/c1-13-7(12)6-14-5-3-2-4-8(9,10)11/h2-6H2,1H3
InChIKeyQNGJOPIBHGKMEZ-UHFFFAOYSA-N
MW230.25 g/mol
LogP2.63
Rot. Bonds6

About methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate

methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate (PubChem CID 123894858) has the molecular formula C8H13F3O2S and a molecular weight of 230.25 g/mol. Its IUPAC name is methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate.

Molecular Properties

Compound Namemethyl 2-(5,5,5-trifluoropentylsulfanyl)acetate
PubChem CID123894858
Molecular FormulaC8H13F3O2S
Molecular Weight230.25 g/mol
Exact Mass230.06
IUPAC Namemethyl 2-(5,5,5-trifluoropentylsulfanyl)acetate
SMILESCOC(=O)CSCCCCC(F)(F)F
InChIInChI=1S/C8H13F3O2S/c1-13-7(12)6-14-5-3-2-4-8(9,10)11/h2-6H2,1H3
InChIKeyQNGJOPIBHGKMEZ-UHFFFAOYSA-N
XLogP2.63
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500230.25
LogP ≤ 52.63
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate?
The IUPAC name of methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate (CID 123894858) is methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate.
What is the SMILES notation for methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate?
The canonical SMILES for methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate is COC(=O)CSCCCCC(F)(F)F.
What is the InChIKey of methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate?
The InChIKey is QNGJOPIBHGKMEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H13F3O2S/c1-13-7(12)6-14-5-3-2-4-8(9,10)11/h2-6H2,1H3.
What are the key properties of methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate?
methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate has a molecular weight of 230.25 g/mol, XLogP of 2.63, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(5,5,5-trifluoropentylsulfanyl)acetate is sourced from PubChem (CID 123894858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).