C10H18F2O2S — CID 123810834
methyl 2-(7,7-difluoroheptylsulfanyl)acetate (PubChem CID 123810834) has the molecular formula C10H18F2O2S and a molecular weight of 240.31 g/mol. Its IUPAC name is methyl 2-(7,7-difluoroheptylsulfanyl)acetate.
| Compound Name | methyl 2-(7,7-difluoroheptylsulfanyl)acetate |
|---|---|
| PubChem CID | 123810834 |
| Molecular Formula | C10H18F2O2S |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | methyl 2-(7,7-difluoroheptylsulfanyl)acetate |
| SMILES | COC(=O)CSCCCCCCC(F)F |
| InChI | InChI=1S/C10H18F2O2S/c1-14-10(13)8-15-7-5-3-2-4-6-9(11)12/h9H,2-8H2,1H3 |
| InChIKey | CLQMSIOZYLIPEW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|