C11H20F2O2S — CID 123992101
2-methylpropyl 2-(5,5-difluoropentylsulfanyl)acetate (PubChem CID 123992101) has the molecular formula C11H20F2O2S and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-methylpropyl 2-(5,5-difluoropentylsulfanyl)acetate.
| Compound Name | 2-methylpropyl 2-(5,5-difluoropentylsulfanyl)acetate |
|---|---|
| PubChem CID | 123992101 |
| Molecular Formula | C11H20F2O2S |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 2-methylpropyl 2-(5,5-difluoropentylsulfanyl)acetate |
| SMILES | CC(C)COC(=O)CSCCCCC(F)F |
| InChI | InChI=1S/C11H20F2O2S/c1-9(2)7-15-11(14)8-16-6-4-3-5-10(12)13/h9-10H,3-8H2,1-2H3 |
| InChIKey | CEEIKAYIGZOKQW-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|