C11H19F3OS — CID 142012408
(Z)-2-methyl-3-(7,7,7-trifluoroheptylsulfanyl)prop-1-en-1-ol (PubChem CID 142012408) has the molecular formula C11H19F3OS and a molecular weight of 256.33 g/mol. Its IUPAC name is (Z)-2-methyl-3-(7,7,7-trifluoroheptylsulfanyl)prop-1-en-1-ol.
| Compound Name | (Z)-2-methyl-3-(7,7,7-trifluoroheptylsulfanyl)prop-1-en-1-ol |
|---|---|
| PubChem CID | 142012408 |
| Molecular Formula | C11H19F3OS |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | (Z)-2-methyl-3-(7,7,7-trifluoroheptylsulfanyl)prop-1-en-1-ol |
| SMILES | C/C(=C/O)CSCCCCCCC(F)(F)F |
| InChI | InChI=1S/C11H19F3OS/c1-10(8-15)9-16-7-5-3-2-4-6-11(12,13)14/h8,15H,2-7,9H2,1H3/b10-8- |
| InChIKey | ACYQIODKNZAGQX-NTMALXAHSA-N |
| XLogP | 4.69 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|