C13H9F15O4S — CID 163324166
2-hydroxy-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylsulfanyl)propanoic acid (PubChem CID 163324166) has the molecular formula C13H9F15O4S and a molecular weight of 546.25 g/mol. Its IUPAC name is 2-hydroxy-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylsulfanyl)propanoic acid.
| Compound Name | 2-hydroxy-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 163324166 |
| Molecular Formula | C13H9F15O4S |
| Molecular Weight | 546.25 g/mol |
| Exact Mass | 546.00 |
| IUPAC Name | 2-hydroxy-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-pentadecafluorodecanoylsulfanyl)propanoic acid |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SCC(O)C(=O)O |
| InChI | InChI=1S/C13H9F15O4S/c14-7(15,2-1-5(30)33-3-4(29)6(31)32)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)13(26,27)28/h4,29H,1-3H2,(H,31,32) |
| InChIKey | WQBOPIXJALOYJO-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.25 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|