C17H7F23O5S — CID 163324193
2-hydroxy-3-oxo-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-tricosafluorotetradecanoylsulfanyl)propanoic acid (PubChem CID 163324193) has the molecular formula C17H7F23O5S and a molecular weight of 760.26 g/mol. Its IUPAC name is 2-hydroxy-3-oxo-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-tricosafluorotetradecanoylsulfanyl)propanoic acid.
| Compound Name | 2-hydroxy-3-oxo-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-tricosafluorotetradecanoylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 163324193 |
| Molecular Formula | C17H7F23O5S |
| Molecular Weight | 760.26 g/mol |
| Exact Mass | 759.96 |
| IUPAC Name | 2-hydroxy-3-oxo-3-(4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,14-tricosafluorotetradecanoylsulfanyl)propanoic acid |
| SMILES | O=C(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)SC(=O)C(O)C(=O)O |
| InChI | InChI=1S/C17H7F23O5S/c18-7(19,2-1-3(41)46-6(45)4(42)5(43)44)8(20,21)9(22,23)10(24,25)11(26,27)12(28,29)13(30,31)14(32,33)15(34,35)16(36,37)17(38,39)40/h4,42H,1-2H2,(H,43,44) |
| InChIKey | QXZPVTMJPBWJCZ-UHFFFAOYSA-N |
| XLogP | 6.91 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.26 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|