C13H21F5O2S — CID 87340880
tert-butyl 2-(5,5,6,6,6-pentafluorohexylsulfanyl)propanoate (PubChem CID 87340880) has the molecular formula C13H21F5O2S and a molecular weight of 336.37 g/mol. Its IUPAC name is tert-butyl 2-(5,5,6,6,6-pentafluorohexylsulfanyl)propanoate.
| Compound Name | tert-butyl 2-(5,5,6,6,6-pentafluorohexylsulfanyl)propanoate |
|---|---|
| PubChem CID | 87340880 |
| Molecular Formula | C13H21F5O2S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | tert-butyl 2-(5,5,6,6,6-pentafluorohexylsulfanyl)propanoate |
| SMILES | CC(SCCCCC(F)(F)C(F)(F)F)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C13H21F5O2S/c1-9(10(19)20-11(2,3)4)21-8-6-5-7-12(14,15)13(16,17)18/h9H,5-8H2,1-4H3 |
| InChIKey | WRJFEDOKPAKMEQ-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|