C12H20F4O2S — CID 87341696
butyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)propanoate (PubChem CID 87341696) has the molecular formula C12H20F4O2S and a molecular weight of 304.35 g/mol. Its IUPAC name is butyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)propanoate.
| Compound Name | butyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)propanoate |
|---|---|
| PubChem CID | 87341696 |
| Molecular Formula | C12H20F4O2S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | butyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)propanoate |
| SMILES | CCCCOC(=O)C(C)SCCCC(F)(F)C(F)F |
| InChI | InChI=1S/C12H20F4O2S/c1-3-4-7-18-10(17)9(2)19-8-5-6-12(15,16)11(13)14/h9,11H,3-8H2,1-2H3 |
| InChIKey | DYASIDMLIUPHEX-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|