C14H24F4O2S — CID 87341659
propan-2-yl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate (PubChem CID 87341659) has the molecular formula C14H24F4O2S and a molecular weight of 332.40 g/mol. Its IUPAC name is propan-2-yl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate.
| Compound Name | propan-2-yl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate |
|---|---|
| PubChem CID | 87341659 |
| Molecular Formula | C14H24F4O2S |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.14 |
| IUPAC Name | propan-2-yl 4-methyl-2-(4,4,5,5-tetrafluoropentylsulfanyl)pentanoate |
| SMILES | CC(C)CC(SCCCC(F)(F)C(F)F)C(=O)OC(C)C |
| InChI | InChI=1S/C14H24F4O2S/c1-9(2)8-11(12(19)20-10(3)4)21-7-5-6-14(17,18)13(15)16/h9-11,13H,5-8H2,1-4H3 |
| InChIKey | RJMXLMANTRYCBL-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|