C10H16F4O2S — CID 123235290
propyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)acetate (PubChem CID 123235290) has the molecular formula C10H16F4O2S and a molecular weight of 276.29 g/mol. Its IUPAC name is propyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)acetate.
| Compound Name | propyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)acetate |
|---|---|
| PubChem CID | 123235290 |
| Molecular Formula | C10H16F4O2S |
| Molecular Weight | 276.29 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | propyl 2-(4,4,5,5-tetrafluoropentylsulfanyl)acetate |
| SMILES | CCCOC(=O)CSCCCC(F)(F)C(F)F |
| InChI | InChI=1S/C10H16F4O2S/c1-2-5-16-8(15)7-17-6-3-4-10(13,14)9(11)12/h9H,2-7H2,1H3 |
| InChIKey | MRPZGLMCXGRFHZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.29 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|