C17H26ClF5O4 — CID 87901812
2-butan-2-yloxycarbonyl-2-(5-chloropentyl)-6,6,7,7,7-pentafluoroheptanoic acid (PubChem CID 87901812) has the molecular formula C17H26ClF5O4 and a molecular weight of 424.83 g/mol. Its IUPAC name is 2-butan-2-yloxycarbonyl-2-(5-chloropentyl)-6,6,7,7,7-pentafluoroheptanoic acid.
| Compound Name | 2-butan-2-yloxycarbonyl-2-(5-chloropentyl)-6,6,7,7,7-pentafluoroheptanoic acid |
|---|---|
| PubChem CID | 87901812 |
| Molecular Formula | C17H26ClF5O4 |
| Molecular Weight | 424.83 g/mol |
| Exact Mass | 424.14 |
| IUPAC Name | 2-butan-2-yloxycarbonyl-2-(5-chloropentyl)-6,6,7,7,7-pentafluoroheptanoic acid |
| SMILES | CCC(C)OC(=O)C(CCCCCCl)(CCCC(F)(F)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C17H26ClF5O4/c1-3-12(2)27-14(26)15(13(24)25,8-5-4-6-11-18)9-7-10-16(19,20)17(21,22)23/h12H,3-11H2,1-2H3,(H,24,25) |
| InChIKey | WIYWKJNFOGNTIA-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.83 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|