C18H20F18O2 — CID 102140386
6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-4,13-bis(trifluoromethyl)hexadecane-1,16-diol (PubChem CID 102140386) has the molecular formula C18H20F18O2 and a molecular weight of 610.32 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-4,13-bis(trifluoromethyl)hexadecane-1,16-diol.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-4,13-bis(trifluoromethyl)hexadecane-1,16-diol |
|---|---|
| PubChem CID | 102140386 |
| Molecular Formula | C18H20F18O2 |
| Molecular Weight | 610.32 g/mol |
| Exact Mass | 610.12 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11-dodecafluoro-4,13-bis(trifluoromethyl)hexadecane-1,16-diol |
| SMILES | OCCCC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CC(CCCO)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C18H20F18O2/c19-11(20,7-9(3-1-5-37)13(23,24)25)15(29,30)17(33,34)18(35,36)16(31,32)12(21,22)8-10(4-2-6-38)14(26,27)28/h9-10,37-38H,1-8H2 |
| InChIKey | ZXGPIKFGIUIZJD-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.32 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|