C10H6F16O — CID 172565081
3,3,4,4,5,5,6,6,7,7,9,9,9-tridecafluoro-8-(trifluoromethyl)nonan-1-ol (PubChem CID 172565081) has the molecular formula C10H6F16O and a molecular weight of 446.13 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,9,9,9-tridecafluoro-8-(trifluoromethyl)nonan-1-ol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,9,9,9-tridecafluoro-8-(trifluoromethyl)nonan-1-ol |
|---|---|
| PubChem CID | 172565081 |
| Molecular Formula | C10H6F16O |
| Molecular Weight | 446.13 g/mol |
| Exact Mass | 446.02 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,9,9,9-tridecafluoro-8-(trifluoromethyl)nonan-1-ol |
| SMILES | OCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C10H6F16O/c11-4(12,1-2-27)8(21,22)10(25,26)9(23,24)5(13,14)3(6(15,16)17)7(18,19)20/h3,27H,1-2H2 |
| InChIKey | QWAVRYRNZREHDZ-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.13 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|