C10H11F11O2 — CID 19768115
3,3,4,4,5,5,6,6,7,7,8-undecafluorodecane-1,10-diol (PubChem CID 19768115) has the molecular formula C10H11F11O2 and a molecular weight of 372.17 g/mol. Its IUPAC name is 3,3,4,4,5,5,6,6,7,7,8-undecafluorodecane-1,10-diol.
| Compound Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluorodecane-1,10-diol |
|---|---|
| PubChem CID | 19768115 |
| Molecular Formula | C10H11F11O2 |
| Molecular Weight | 372.17 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | 3,3,4,4,5,5,6,6,7,7,8-undecafluorodecane-1,10-diol |
| SMILES | OCCC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)CCO |
| InChI | InChI=1S/C10H11F11O2/c11-5(1-3-22)7(14,15)9(18,19)10(20,21)8(16,17)6(12,13)2-4-23/h5,22-23H,1-4H2 |
| InChIKey | XFQSTRBRZJEGFX-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.17 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|