C24H8F36O4 — CID 88844372
bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl) (E)-but-2-enedioate (PubChem CID 88844372) has the molecular formula C24H8F36O4 and a molecular weight of 1044.25 g/mol. Its IUPAC name is bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl) (E)-but-2-enedioate.
| Compound Name | bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl) (E)-but-2-enedioate |
|---|---|
| PubChem CID | 88844372 |
| Molecular Formula | C24H8F36O4 |
| Molecular Weight | 1044.25 g/mol |
| Exact Mass | 1043.98 |
| IUPAC Name | bis(1,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-octadecafluorodecyl) (E)-but-2-enedioate |
| SMILES | O=C(/C=C/C(=O)OC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC(F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C24H8F36O4/c25-5(3-9(27,28)11(31,32)13(35,36)15(39,40)17(43,44)19(47,48)21(51,52)23(55,56)57)63-7(61)1-2-8(62)64-6(26)4-10(29,30)12(33,34)14(37,38)16(41,42)18(45,46)20(49,50)22(53,54)24(58,59)60/h1-2,5-6H,3-4H2/b2-1+ |
| InChIKey | ONDNPMVTHOMBDY-OWOJBTEDSA-N |
| XLogP | 12.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1044.25 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|