C18H6F20O2 — CID 159116751
[3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)nonyl] prop-2-enoate (PubChem CID 159116751) has the molecular formula C18H6F20O2 and a molecular weight of 634.20 g/mol. Its IUPAC name is [3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)nonyl] prop-2-enoate.
| Compound Name | [3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)nonyl] prop-2-enoate |
|---|---|
| PubChem CID | 159116751 |
| Molecular Formula | C18H6F20O2 |
| Molecular Weight | 634.20 g/mol |
| Exact Mass | 634.00 |
| IUPAC Name | [3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoro-1-(2,3,4,5,6-pentafluorophenyl)nonyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C18H6F20O2/c1-2-5(39)40-4(6-7(19)9(21)11(23)10(22)8(6)20)3-12(24,25)13(26,27)14(28,29)15(30,31)16(32,33)17(34,35)18(36,37)38/h2,4H,1,3H2 |
| InChIKey | KQMRMSZASGVCMZ-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.20 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|