C21H13F30NO2 — CID 163324471
3-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid (PubChem CID 163324471) has the molecular formula C21H13F30NO2 and a molecular weight of 881.28 g/mol. Its IUPAC name is 3-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid.
| Compound Name | 3-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid |
|---|---|
| PubChem CID | 163324471 |
| Molecular Formula | C21H13F30NO2 |
| Molecular Weight | 881.28 g/mol |
| Exact Mass | 881.05 |
| IUPAC Name | 3-[3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecyl(3,3,4,4,5,5,6,6,7,7,8,8,8-tridecafluorooctyl)amino]propanoic acid |
| SMILES | O=C(O)CCN(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H13F30NO2/c22-8(23,10(26,27)12(30,31)14(34,35)15(36,37)17(40,41)19(44,45)21(49,50)51)2-5-52(4-1-7(53)54)6-3-9(24,25)11(28,29)13(32,33)16(38,39)18(42,43)20(46,47)48/h1-6H2,(H,53,54) |
| InChIKey | BZLROYIEUXHARU-UHFFFAOYSA-N |
| XLogP | 10.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.28 |
| LogP ≤ 5 | 10.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|