C24H27F17N4O9 — CID 22352696
2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylamino)-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid (PubChem CID 22352696) has the molecular formula C24H27F17N4O9 and a molecular weight of 838.46 g/mol. Its IUPAC name is 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylamino)-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid.
| Compound Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylamino)-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
|---|---|
| PubChem CID | 22352696 |
| Molecular Formula | C24H27F17N4O9 |
| Molecular Weight | 838.46 g/mol |
| Exact Mass | 838.15 |
| IUPAC Name | 2-[2-[2-[bis(carboxymethyl)amino]ethyl-[2-(3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-heptadecafluorodecylamino)-2-oxoethyl]amino]ethyl-(carboxymethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CCN(CC(=O)O)CC(=O)O)CC(=O)NCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)CC(=O)O |
| InChI | InChI=1S/C24H27F17N4O9/c25-17(26,18(27,28)19(29,30)20(31,32)21(33,34)22(35,36)23(37,38)24(39,40)41)1-2-42-12(46)7-43(3-5-44(8-13(47)48)9-14(49)50)4-6-45(10-15(51)52)11-16(53)54/h1-11H2,(H,42,46)(H,47,48)(H,49,50)(H,51,52)(H,53,54) |
| InChIKey | NRGPAHOXBFKYBG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 188.02 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.46 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|