C7H5F9O — CID 98047511
(Z,4S)-4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-en-1-ol (PubChem CID 98047511) has the molecular formula C7H5F9O and a molecular weight of 276.10 g/mol. Its IUPAC name is (Z,4S)-4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-en-1-ol.
| Compound Name | (Z,4S)-4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-en-1-ol |
|---|---|
| PubChem CID | 98047511 |
| Molecular Formula | C7H5F9O |
| Molecular Weight | 276.10 g/mol |
| Exact Mass | 276.02 |
| IUPAC Name | (Z,4S)-4,5,5,6,6,6-hexafluoro-4-(trifluoromethyl)hex-2-en-1-ol |
| SMILES | OC/C=C\[C@@](F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H5F9O/c8-4(2-1-3-17,6(11,12)13)5(9,10)7(14,15)16/h1-2,17H,3H2/b2-1-/t4-/m0/s1 |
| InChIKey | ICPWRRKQWSNHQB-XDSMRRFISA-N |
| XLogP | 3.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.10 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|