C5HF9O6S3-2 — CID 89187666
1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethanedisulfinate (PubChem CID 89187666) has the molecular formula C5HF9O6S3-2 and a molecular weight of 424.24 g/mol. Its IUPAC name is 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethanedisulfinate.
| Compound Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethanedisulfinate |
|---|---|
| PubChem CID | 89187666 |
| Molecular Formula | C5HF9O6S3-2 |
| Molecular Weight | 424.24 g/mol |
| Exact Mass | 423.88 |
| IUPAC Name | 1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethanedisulfinate |
| SMILES | O=S([O-])C(S(=O)[O-])S(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H3F9O6S3/c6-2(7,4(10,11)12)3(8,9)5(13,14)23(19,20)1(21(15)16)22(17)18/h1H,(H,15,16)(H,17,18)/p-2 |
| InChIKey | KZPWBXJYIQNDOD-UHFFFAOYSA-L |
| XLogP | 0.87 |
| TPSA | 114.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|