C8HF17NaO2S — CID 170845218
CID 170845218 (PubChem CID 170845218) has the molecular formula C8HF17NaO2S and a molecular weight of 507.12 g/mol.
| Compound Name | CID 170845218 |
|---|---|
| PubChem CID | 170845218 |
| Molecular Formula | C8HF17NaO2S |
| Molecular Weight | 507.12 g/mol |
| Exact Mass | 506.93 |
| IUPAC Name | — |
| SMILES | O=S(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[Na] |
| InChI | InChI=1S/C8HF17O2S.Na/c9-1(10,3(13,14)5(17,18)7(21,22)23)2(11,12)4(15,16)6(19,20)8(24,25)28(26)27;/h(H,26,27); |
| InChIKey | WSOYKSAMEZZAOJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.12 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|