About CID 131886742
CID 131886742 (PubChem CID 131886742) has the molecular formula C2HClF4NaO2S
and a molecular weight of 223.53 g/mol.
Molecular Properties
| Compound Name | CID 131886742 |
| PubChem CID | 131886742 |
| Molecular Formula | C2HClF4NaO2S |
| Molecular Weight | 223.53 g/mol |
| Exact Mass | 222.92 |
| IUPAC Name | — |
| SMILES | O=S(O)C(F)(F)C(F)(F)Cl.[Na] |
| InChI | InChI=1S/C2HClF4O2S.Na/c3-1(4,5)2(6,7)10(8)9;/h(H,8,9); |
| InChIKey | KBUJZOQDTXBCGF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.53 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|
Analyze CID 131886742 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 131886742?
The IUPAC name of CID 131886742 (CID 131886742) is not available.
What is the SMILES notation for CID 131886742?
The canonical SMILES for CID 131886742 is O=S(O)C(F)(F)C(F)(F)Cl.[Na].
What is the InChIKey of CID 131886742?
The InChIKey is KBUJZOQDTXBCGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HClF4O2S.Na/c3-1(4,5)2(6,7)10(8)9;/h(H,8,9);.
What are the key properties of CID 131886742?
CID 131886742 has a molecular weight of 223.53 g/mol, XLogP of 1.25, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 131886742 is sourced from PubChem (CID 131886742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).