C4H3F6NO4S2 — CID 89288958
1,1,2,2,3,3-hexafluoro-3-(methylideneamino)sulfonylpropane-1-sulfinic acid (PubChem CID 89288958) has the molecular formula C4H3F6NO4S2 and a molecular weight of 307.19 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(methylideneamino)sulfonylpropane-1-sulfinic acid.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(methylideneamino)sulfonylpropane-1-sulfinic acid |
|---|---|
| PubChem CID | 89288958 |
| Molecular Formula | C4H3F6NO4S2 |
| Molecular Weight | 307.19 g/mol |
| Exact Mass | 306.94 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(methylideneamino)sulfonylpropane-1-sulfinic acid |
| SMILES | C=NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)S(=O)O |
| InChI | InChI=1S/C4H3F6NO4S2/c1-11-17(14,15)4(9,10)2(5,6)3(7,8)16(12)13/h1H2,(H,12,13) |
| InChIKey | SHEIMTHKCSKBLR-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.19 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|