C5H6F5NO4S2 — CID 155480913
1,1,2,2,3-pentafluoro-3-sulfamoylpent-4-ene-1-sulfinic acid (PubChem CID 155480913) has the molecular formula C5H6F5NO4S2 and a molecular weight of 303.23 g/mol. Its IUPAC name is 1,1,2,2,3-pentafluoro-3-sulfamoylpent-4-ene-1-sulfinic acid.
| Compound Name | 1,1,2,2,3-pentafluoro-3-sulfamoylpent-4-ene-1-sulfinic acid |
|---|---|
| PubChem CID | 155480913 |
| Molecular Formula | C5H6F5NO4S2 |
| Molecular Weight | 303.23 g/mol |
| Exact Mass | 302.97 |
| IUPAC Name | 1,1,2,2,3-pentafluoro-3-sulfamoylpent-4-ene-1-sulfinic acid |
| SMILES | C=CC(F)(C(F)(F)C(F)(F)S(=O)O)S(N)(=O)=O |
| InChI | InChI=1S/C5H6F5NO4S2/c1-2-3(6,17(11,14)15)4(7,8)5(9,10)16(12)13/h2H,1H2,(H,12,13)(H2,11,14,15) |
| InChIKey | JNMNBDPBZYPFBO-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.23 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|