C4F9NO6S3-2 — CID 123959260
1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylazanidylsulfonyl)propane-1-sulfinate (PubChem CID 123959260) has the molecular formula C4F9NO6S3-2 and a molecular weight of 425.23 g/mol. Its IUPAC name is 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylazanidylsulfonyl)propane-1-sulfinate.
| Compound Name | 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylazanidylsulfonyl)propane-1-sulfinate |
|---|---|
| PubChem CID | 123959260 |
| Molecular Formula | C4F9NO6S3-2 |
| Molecular Weight | 425.23 g/mol |
| Exact Mass | 424.88 |
| IUPAC Name | 1,1,2,2,3,3-hexafluoro-3-(trifluoromethylsulfonylazanidylsulfonyl)propane-1-sulfinate |
| SMILES | O=S([O-])C(F)(F)C(F)(F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C4HF9NO6S3/c5-1(6,2(7,8)21(15)16)3(9,10)22(17,18)14-23(19,20)4(11,12)13/h(H,15,16)/q-1/p-1 |
| InChIKey | RSFMGAUIQGXDEM-UHFFFAOYSA-M |
| XLogP | 1.24 |
| TPSA | 122.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.23 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|