C12H9F17NO4S- — CID 175369304
1-[2,2-dimethoxyethyl(sulfinato)amino]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane (PubChem CID 175369304) has the molecular formula C12H9F17NO4S- and a molecular weight of 586.24 g/mol. Its IUPAC name is 1-[2,2-dimethoxyethyl(sulfinato)amino]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane.
| Compound Name | 1-[2,2-dimethoxyethyl(sulfinato)amino]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
|---|---|
| PubChem CID | 175369304 |
| Molecular Formula | C12H9F17NO4S- |
| Molecular Weight | 586.24 g/mol |
| Exact Mass | 586.00 |
| IUPAC Name | 1-[2,2-dimethoxyethyl(sulfinato)amino]-1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane |
| SMILES | COC(CN(S(=O)[O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)OC |
| InChI | InChI=1S/C12H10F17NO4S/c1-33-4(34-2)3-30(35(31)32)12(28,29)10(23,24)8(19,20)6(15,16)5(13,14)7(17,18)9(21,22)11(25,26)27/h4H,3H2,1-2H3,(H,31,32)/p-1 |
| InChIKey | ZWPONJBYRXXYQJ-UHFFFAOYSA-M |
| XLogP | 4.67 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.24 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|